C14H18F3NO2 — CID 134858827
N-(1,1,1-trifluoro-3-methoxy-5-phenylpentan-3-yl)acetamide (PubChem CID 134858827) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-(1,1,1-trifluoro-3-methoxy-5-phenylpentan-3-yl)acetamide.
| Compound Name | N-(1,1,1-trifluoro-3-methoxy-5-phenylpentan-3-yl)acetamide |
|---|---|
| PubChem CID | 134858827 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(1,1,1-trifluoro-3-methoxy-5-phenylpentan-3-yl)acetamide |
| SMILES | COC(CCc1ccccc1)(CC(F)(F)F)NC(C)=O |
| InChI | InChI=1S/C14H18F3NO2/c1-11(19)18-13(20-2,10-14(15,16)17)9-8-12-6-4-3-5-7-12/h3-7H,8-10H2,1-2H3,(H,18,19) |
| InChIKey | SAUXMRQYINSSQE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|