C16H12O3 — CID 134862672
(7Z)-7-benzylidene-5H-furo[3,4-f][1,3]benzodioxole (PubChem CID 134862672) has the molecular formula C16H12O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is (7Z)-7-benzylidene-5H-furo[3,4-f][1,3]benzodioxole.
| Compound Name | (7Z)-7-benzylidene-5H-furo[3,4-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 134862672 |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (7Z)-7-benzylidene-5H-furo[3,4-f][1,3]benzodioxole |
| SMILES | C(=C1\OCc2cc3c(cc21)OCO3)\c1ccccc1 |
| InChI | InChI=1S/C16H12O3/c1-2-4-11(5-3-1)6-14-13-8-16-15(18-10-19-16)7-12(13)9-17-14/h1-8H,9-10H2/b14-6- |
| InChIKey | VMZLOIASPPXCBR-NSIKDUERSA-N |
| XLogP | 3.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|