C18H16O3 — CID 102593158
(5Z)-5-benzylidene-7,7-dimethylfuro[3,4-f][1,3]benzodioxole (PubChem CID 102593158) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is (5Z)-5-benzylidene-7,7-dimethylfuro[3,4-f][1,3]benzodioxole.
| Compound Name | (5Z)-5-benzylidene-7,7-dimethylfuro[3,4-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 102593158 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (5Z)-5-benzylidene-7,7-dimethylfuro[3,4-f][1,3]benzodioxole |
| SMILES | CC1(C)O/C(=C\c2ccccc2)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C18H16O3/c1-18(2)14-10-17-16(19-11-20-17)9-13(14)15(21-18)8-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3/b15-8- |
| InChIKey | JJBVMXRALBSWEW-NVNXTCNLSA-N |
| XLogP | 4.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|