C13H17NO3 — CID 82194483
6,6,8-trimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-amine (PubChem CID 82194483) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 6,6,8-trimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-amine.
| Compound Name | 6,6,8-trimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-amine |
|---|---|
| PubChem CID | 82194483 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 6,6,8-trimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-amine |
| SMILES | CC1(C)CC(C)(N)c2cc3c(cc2O1)OCO3 |
| InChI | InChI=1S/C13H17NO3/c1-12(2)6-13(3,14)8-4-10-11(16-7-15-10)5-9(8)17-12/h4-5H,6-7,14H2,1-3H3 |
| InChIKey | ZOZDVBPVHYKYED-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |