C26H31NO4 — CID 143139012
3',5,5,9',9'-pentamethylspiro[6H-cyclopenta[f][1,3]benzodioxole-7,6'-7,8-dihydro-2H-benzo[g][1,4]benzodioxine]-3'-amine (PubChem CID 143139012) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 3',5,5,9',9'-pentamethylspiro[6H-cyclopenta[f][1,3]benzodioxole-7,6'-7,8-dihydro-2H-benzo[g][1,4]benzodioxine]-3'-amine.
| Compound Name | 3',5,5,9',9'-pentamethylspiro[6H-cyclopenta[f][1,3]benzodioxole-7,6'-7,8-dihydro-2H-benzo[g][1,4]benzodioxine]-3'-amine |
|---|---|
| PubChem CID | 143139012 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 3',5,5,9',9'-pentamethylspiro[6H-cyclopenta[f][1,3]benzodioxole-7,6'-7,8-dihydro-2H-benzo[g][1,4]benzodioxine]-3'-amine |
| SMILES | CC1(N)COc2cc3c(cc2O1)C1(CCC3(C)C)CC(C)(C)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C26H31NO4/c1-23(2)6-7-26(18-11-22-21(8-15(18)23)28-13-25(5,27)31-22)12-24(3,4)16-9-19-20(10-17(16)26)30-14-29-19/h8-11H,6-7,12-14,27H2,1-5H3 |
| InChIKey | YXCGUIOXKJZMFX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |