C29H48O7Si — CID 134864646
methyl (Z,4S,5S)-6-[2-[(E)-[(3R,4aR)-3-ethoxy-3,4,4a,5,6,7-hexahydroisochromen-8-ylidene]methyl]-1,3-dioxolan-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enoate (PubChem CID 134864646) has the molecular formula C29H48O7Si and a molecular weight of 536.78 g/mol. Its IUPAC name is methyl (Z,4S,5S)-6-[2-[(E)-[(3R,4aR)-3-ethoxy-3,4,4a,5,6,7-hexahydroisochromen-8-ylidene]methyl]-1,3-dioxolan-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enoate.
| Compound Name | methyl (Z,4S,5S)-6-[2-[(E)-[(3R,4aR)-3-ethoxy-3,4,4a,5,6,7-hexahydroisochromen-8-ylidene]methyl]-1,3-dioxolan-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enoate |
|---|---|
| PubChem CID | 134864646 |
| Molecular Formula | C29H48O7Si |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | methyl (Z,4S,5S)-6-[2-[(E)-[(3R,4aR)-3-ethoxy-3,4,4a,5,6,7-hexahydroisochromen-8-ylidene]methyl]-1,3-dioxolan-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enoate |
| SMILES | CCO[C@H]1C[C@H]2CCC/C(=C\C3(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C\C(=O)OC)OCCO3)C2=CO1 |
| InChI | InChI=1S/C29H48O7Si/c1-9-32-27-17-22-11-10-12-23(24(22)20-33-27)18-29(34-15-16-35-29)19-25(21(2)13-14-26(30)31-6)36-37(7,8)28(3,4)5/h13-14,18,20-22,25,27H,9-12,15-17,19H2,1-8H3/b14-13-,23-18+/t21-,22+,25-,27+/m0/s1 |
| InChIKey | LTWLLXTUKHKRKT-NCBXUKKCSA-N |
| XLogP | 6.27 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|