C28H36O10 — CID 134864723
ethyl 2-[(7R,11S)-7-[2-(2-ethoxy-2-oxoethyl)-4,5-dimethoxyphenyl]-3,3,10-trimethyl-1,5-dioxo-2,4-dioxaspiro[5.5]undec-9-en-11-yl]acetate (PubChem CID 134864723) has the molecular formula C28H36O10 and a molecular weight of 532.59 g/mol. Its IUPAC name is ethyl 2-[(7R,11S)-7-[2-(2-ethoxy-2-oxoethyl)-4,5-dimethoxyphenyl]-3,3,10-trimethyl-1,5-dioxo-2,4-dioxaspiro[5.5]undec-9-en-11-yl]acetate.
| Compound Name | ethyl 2-[(7R,11S)-7-[2-(2-ethoxy-2-oxoethyl)-4,5-dimethoxyphenyl]-3,3,10-trimethyl-1,5-dioxo-2,4-dioxaspiro[5.5]undec-9-en-11-yl]acetate |
|---|---|
| PubChem CID | 134864723 |
| Molecular Formula | C28H36O10 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | ethyl 2-[(7R,11S)-7-[2-(2-ethoxy-2-oxoethyl)-4,5-dimethoxyphenyl]-3,3,10-trimethyl-1,5-dioxo-2,4-dioxaspiro[5.5]undec-9-en-11-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(OC)c(OC)cc1[C@H]1CC=C(C)[C@H](CC(=O)OCC)C12C(=O)OC(C)(C)OC2=O |
| InChI | InChI=1S/C28H36O10/c1-8-35-23(29)13-17-12-21(33-6)22(34-7)14-18(17)19-11-10-16(3)20(15-24(30)36-9-2)28(19)25(31)37-27(4,5)38-26(28)32/h10,12,14,19-20H,8-9,11,13,15H2,1-7H3/t19-,20+/m1/s1 |
| InChIKey | RKEMBAQRIZOBOJ-UXHICEINSA-N |
| XLogP | 3.63 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|