C47H51NO7 — CID 134864836
methyl (2S)-2-(benzylamino)-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate (PubChem CID 134864836) has the molecular formula C47H51NO7 and a molecular weight of 741.93 g/mol. Its IUPAC name is methyl (2S)-2-(benzylamino)-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate.
| Compound Name | methyl (2S)-2-(benzylamino)-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 134864836 |
| Molecular Formula | C47H51NO7 |
| Molecular Weight | 741.93 g/mol |
| Exact Mass | 741.37 |
| IUPAC Name | methyl (2S)-2-(benzylamino)-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate |
| SMILES | C=CC[C@@]1([C@H](NCc2ccccc2)C(=O)OC)OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C47H51NO7/c1-3-29-47(44(46(49)50-2)48-30-36-19-9-4-10-20-36)45(54-34-40-27-17-8-18-28-40)43(53-33-39-25-15-7-16-26-39)42(52-32-38-23-13-6-14-24-38)41(55-47)35-51-31-37-21-11-5-12-22-37/h3-28,41-45,48H,1,29-35H2,2H3/t41?,42-,43?,44-,45?,47+/m1/s1 |
| InChIKey | DHPPJGZPILUHMC-XAPOHPAASA-N |
| XLogP | 8.00 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.93 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|