C23H36O6 — CID 134867385
ethyl (E)-7-[(2R,3S,6S)-3-(methoxymethoxy)-3-methyl-6-[(E)-4-oxobut-2-en-2-yl]oxan-2-yl]-5-methyl-2-methylidenehept-4-enoate (PubChem CID 134867385) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is ethyl (E)-7-[(2R,3S,6S)-3-(methoxymethoxy)-3-methyl-6-[(E)-4-oxobut-2-en-2-yl]oxan-2-yl]-5-methyl-2-methylidenehept-4-enoate.
| Compound Name | ethyl (E)-7-[(2R,3S,6S)-3-(methoxymethoxy)-3-methyl-6-[(E)-4-oxobut-2-en-2-yl]oxan-2-yl]-5-methyl-2-methylidenehept-4-enoate |
|---|---|
| PubChem CID | 134867385 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | ethyl (E)-7-[(2R,3S,6S)-3-(methoxymethoxy)-3-methyl-6-[(E)-4-oxobut-2-en-2-yl]oxan-2-yl]-5-methyl-2-methylidenehept-4-enoate |
| SMILES | C=C(C/C=C(\C)CC[C@H]1O[C@H](/C(C)=C/C=O)CC[C@]1(C)OCOC)C(=O)OCC |
| InChI | InChI=1S/C23H36O6/c1-7-27-22(25)19(4)10-8-17(2)9-11-21-23(5,28-16-26-6)14-12-20(29-21)18(3)13-15-24/h8,13,15,20-21H,4,7,9-12,14,16H2,1-3,5-6H3/b17-8+,18-13+/t20-,21+,23-/m0/s1 |
| InChIKey | WALXTUWYCRUJRU-VPAPPXOVSA-N |
| XLogP | 4.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|