C23H40O7 — CID 154093322
(4,5,5,6,6-pentaethoxy-4-propylcyclohex-2-en-1-yl) 2-methylprop-2-enoate (PubChem CID 154093322) has the molecular formula C23H40O7 and a molecular weight of 428.57 g/mol. Its IUPAC name is (4,5,5,6,6-pentaethoxy-4-propylcyclohex-2-en-1-yl) 2-methylprop-2-enoate.
| Compound Name | (4,5,5,6,6-pentaethoxy-4-propylcyclohex-2-en-1-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154093322 |
| Molecular Formula | C23H40O7 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (4,5,5,6,6-pentaethoxy-4-propylcyclohex-2-en-1-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C=CC(CCC)(OCC)C(OCC)(OCC)C1(OCC)OCC |
| InChI | InChI=1S/C23H40O7/c1-9-16-21(25-10-2)17-15-19(30-20(24)18(7)8)22(26-11-3,27-12-4)23(21,28-13-5)29-14-6/h15,17,19H,7,9-14,16H2,1-6,8H3 |
| InChIKey | LKWIHEWORSWTJM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|