C26H27N3O3S — CID 134870219
ethyl 4-benzoyl-2-(methyliminomethylamino)-5-methylsulfanyl-6-(2-phenylethyl)pyridine-3-carboxylate (PubChem CID 134870219) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is ethyl 4-benzoyl-2-(methyliminomethylamino)-5-methylsulfanyl-6-(2-phenylethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 4-benzoyl-2-(methyliminomethylamino)-5-methylsulfanyl-6-(2-phenylethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134870219 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | ethyl 4-benzoyl-2-(methyliminomethylamino)-5-methylsulfanyl-6-(2-phenylethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(N/C=N/C)nc(CCc2ccccc2)c(SC)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O3S/c1-4-32-26(31)22-21(23(30)19-13-9-6-10-14-19)24(33-3)20(29-25(22)28-17-27-2)16-15-18-11-7-5-8-12-18/h5-14,17H,4,15-16H2,1-3H3,(H,27,28,29) |
| InChIKey | BTQIGTJEROJZNM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|