C18H15BrMgN2O2 — CID 134870954
magnesium;1,3-dibenzyl-5H-pyrimidin-5-ide-2,4-dione;bromide (PubChem CID 134870954) has the molecular formula C18H15BrMgN2O2 and a molecular weight of 395.54 g/mol. Its IUPAC name is magnesium;1,3-dibenzyl-5H-pyrimidin-5-ide-2,4-dione;bromide.
| Compound Name | magnesium;1,3-dibenzyl-5H-pyrimidin-5-ide-2,4-dione;bromide |
|---|---|
| PubChem CID | 134870954 |
| Molecular Formula | C18H15BrMgN2O2 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | magnesium;1,3-dibenzyl-5H-pyrimidin-5-ide-2,4-dione;bromide |
| SMILES | O=c1[c-]cn(Cc2ccccc2)c(=O)n1Cc1ccccc1.[Br-].[Mg+2] |
| InChI | InChI=1S/C18H15N2O2.BrH.Mg/c21-17-11-12-19(13-15-7-3-1-4-8-15)18(22)20(17)14-16-9-5-2-6-10-16;;/h1-10,12H,13-14H2;1H;/q-1;;+2/p-1 |
| InChIKey | KEQHLBQMXIUMED-UHFFFAOYSA-M |
| XLogP | -1.47 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|