C7H11Cl3N4 — CID 134871126
N,N'-bis(C-chloro-N-ethylcarbonimidoyl)carbamimidoyl chloride (PubChem CID 134871126) has the molecular formula C7H11Cl3N4 and a molecular weight of 257.55 g/mol. Its IUPAC name is N,N'-bis(C-chloro-N-ethylcarbonimidoyl)carbamimidoyl chloride.
| Compound Name | N,N'-bis(C-chloro-N-ethylcarbonimidoyl)carbamimidoyl chloride |
|---|---|
| PubChem CID | 134871126 |
| Molecular Formula | C7H11Cl3N4 |
| Molecular Weight | 257.55 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | N,N'-bis(C-chloro-N-ethylcarbonimidoyl)carbamimidoyl chloride |
| SMILES | CC/N=C(Cl)/N=C(\Cl)N/C(Cl)=N/CC |
| InChI | InChI=1S/C7H11Cl3N4/c1-3-11-5(8)13-7(10)14-6(9)12-4-2/h3-4H2,1-2H3,(H,11,12,13,14) |
| InChIKey | JREMYGAYAAJGCK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|