About ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide
ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide (PubChem CID 143733110) has the molecular formula C11H27N3
and a molecular weight of 201.36 g/mol. Its IUPAC name is ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide.
Molecular Properties
| Compound Name | ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide |
| PubChem CID | 143733110 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide |
| SMILES | CC.CC.CC/N=C(\C)N/C(C)=N/C |
| InChI | InChI=1S/C7H15N3.2C2H6/c1-5-9-7(3)10-6(2)8-4;2*1-2/h5H2,1-4H3,(H,8,9,10);2*1-2H3 |
| InChIKey | JIZKMAMDYKZVPS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide?
The IUPAC name of ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide (CID 143733110) is ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide.
What is the SMILES notation for ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide?
The canonical SMILES for ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide is CC.CC.CC/N=C(\C)N/C(C)=N/C.
What is the InChIKey of ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide?
The InChIKey is JIZKMAMDYKZVPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3.2C2H6/c1-5-9-7(3)10-6(2)8-4;2*1-2/h5H2,1-4H3,(H,8,9,10);2*1-2H3.
What are the key properties of ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide?
ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide has a molecular weight of 201.36 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(N-ethyl-C-methylcarbonimidoyl)-N'-methylethanimidamide is sourced from PubChem (CID 143733110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).