About N-amino-N'-methylethanimidamide;molecular hydrogen
N-amino-N'-methylethanimidamide;molecular hydrogen (PubChem CID 142049253) has the molecular formula C3H11N3
and a molecular weight of 89.14 g/mol. Its IUPAC name is N-amino-N'-methylethanimidamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-amino-N'-methylethanimidamide;molecular hydrogen |
| PubChem CID | 142049253 |
| Molecular Formula | C3H11N3 |
| Molecular Weight | 89.14 g/mol |
| Exact Mass | 89.10 |
| IUPAC Name | N-amino-N'-methylethanimidamide;molecular hydrogen |
| SMILES | C/N=C(\C)NN.[H][H] |
| InChI | InChI=1S/C3H9N3.H2/c1-3(5-2)6-4;/h4H2,1-2H3,(H,5,6);1H |
| InChIKey | MJHAUNKRHRTZJD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.14 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-methylethanimidamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-methylethanimidamide;molecular hydrogen?
The IUPAC name of N-amino-N'-methylethanimidamide;molecular hydrogen (CID 142049253) is N-amino-N'-methylethanimidamide;molecular hydrogen.
What is the SMILES notation for N-amino-N'-methylethanimidamide;molecular hydrogen?
The canonical SMILES for N-amino-N'-methylethanimidamide;molecular hydrogen is C/N=C(\C)NN.[H][H].
What is the InChIKey of N-amino-N'-methylethanimidamide;molecular hydrogen?
The InChIKey is MJHAUNKRHRTZJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3.H2/c1-3(5-2)6-4;/h4H2,1-2H3,(H,5,6);1H.
What are the key properties of N-amino-N'-methylethanimidamide;molecular hydrogen?
N-amino-N'-methylethanimidamide;molecular hydrogen has a molecular weight of 89.14 g/mol, XLogP of -0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-methylethanimidamide;molecular hydrogen is sourced from PubChem (CID 142049253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).