C5H8Cl2S — CID 134875930
2-[(E)-1,2-dichloroethenyl]sulfanylpropane (PubChem CID 134875930) has the molecular formula C5H8Cl2S and a molecular weight of 171.09 g/mol. Its IUPAC name is 2-[(E)-1,2-dichloroethenyl]sulfanylpropane.
| Compound Name | 2-[(E)-1,2-dichloroethenyl]sulfanylpropane |
|---|---|
| PubChem CID | 134875930 |
| Molecular Formula | C5H8Cl2S |
| Molecular Weight | 171.09 g/mol |
| Exact Mass | 169.97 |
| IUPAC Name | 2-[(E)-1,2-dichloroethenyl]sulfanylpropane |
| SMILES | CC(C)S/C(Cl)=C\Cl |
| InChI | InChI=1S/C5H8Cl2S/c1-4(2)8-5(7)3-6/h3-4H,1-2H3/b5-3- |
| InChIKey | LLHLYYJVJYRAPC-HYXAFXHYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.09 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |