About 2-hexyl-6-iodooxane
2-hexyl-6-iodooxane (PubChem CID 134876178) has the molecular formula C11H21IO
and a molecular weight of 296.19 g/mol. Its IUPAC name is 2-hexyl-6-iodooxane.
Molecular Properties
| Compound Name | 2-hexyl-6-iodooxane |
| PubChem CID | 134876178 |
| Molecular Formula | C11H21IO |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-hexyl-6-iodooxane |
| SMILES | CCCCCCC1CCCC(I)O1 |
| InChI | InChI=1S/C11H21IO/c1-2-3-4-5-7-10-8-6-9-11(12)13-10/h10-11H,2-9H2,1H3 |
| InChIKey | ULSOJBGSTRXSIO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-6-iodooxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-6-iodooxane?
The IUPAC name of 2-hexyl-6-iodooxane (CID 134876178) is 2-hexyl-6-iodooxane.
What is the SMILES notation for 2-hexyl-6-iodooxane?
The canonical SMILES for 2-hexyl-6-iodooxane is CCCCCCC1CCCC(I)O1.
What is the InChIKey of 2-hexyl-6-iodooxane?
The InChIKey is ULSOJBGSTRXSIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21IO/c1-2-3-4-5-7-10-8-6-9-11(12)13-10/h10-11H,2-9H2,1H3.
What are the key properties of 2-hexyl-6-iodooxane?
2-hexyl-6-iodooxane has a molecular weight of 296.19 g/mol, XLogP of 4.29, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-6-iodooxane is sourced from PubChem (CID 134876178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).