C20H20CrO6 — CID 134877921
carbon monoxide;1-[(2E,6E)-2,6-dimethyldeca-2,6-dien-9-ynoxy]prop-2-enylidenechromium (PubChem CID 134877921) has the molecular formula C20H20CrO6 and a molecular weight of 408.37 g/mol. Its IUPAC name is carbon monoxide;1-[(2E,6E)-2,6-dimethyldeca-2,6-dien-9-ynoxy]prop-2-enylidenechromium.
| Compound Name | carbon monoxide;1-[(2E,6E)-2,6-dimethyldeca-2,6-dien-9-ynoxy]prop-2-enylidenechromium |
|---|---|
| PubChem CID | 134877921 |
| Molecular Formula | C20H20CrO6 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | carbon monoxide;1-[(2E,6E)-2,6-dimethyldeca-2,6-dien-9-ynoxy]prop-2-enylidenechromium |
| SMILES | C#CC/C=C(\C)CC/C=C(\C)COC(=[Cr])C=C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C15H20O.5CO.Cr/c1-5-7-9-14(3)10-8-11-15(4)13-16-12-6-2;5*1-2;/h1,6,9,11H,2,7-8,10,13H2,3-4H3;;;;;;/b14-9+,15-11+;;;;;; |
| InChIKey | BIKCVJGBWUZDDH-JICMNHJRSA-N |
| XLogP | 3.37 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|