C16H24O2 — CID 135072461
(E)-6-methyl-3-(2-methylprop-2-enoxy)-8-prop-2-enoxyoct-6-en-1-yne (PubChem CID 135072461) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (E)-6-methyl-3-(2-methylprop-2-enoxy)-8-prop-2-enoxyoct-6-en-1-yne.
| Compound Name | (E)-6-methyl-3-(2-methylprop-2-enoxy)-8-prop-2-enoxyoct-6-en-1-yne |
|---|---|
| PubChem CID | 135072461 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (E)-6-methyl-3-(2-methylprop-2-enoxy)-8-prop-2-enoxyoct-6-en-1-yne |
| SMILES | C#CC(CC/C(C)=C/COCC=C)OCC(=C)C |
| InChI | InChI=1S/C16H24O2/c1-6-11-17-12-10-15(5)8-9-16(7-2)18-13-14(3)4/h2,6,10,16H,1,3,8-9,11-13H2,4-5H3/b15-10+ |
| InChIKey | PGSVGKVIOBJVRI-XNTDXEJSSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|