C19H16N4O3S — CID 134878832
5-azido-2-(4-methylphenyl)sulfonyl-4,5-dihydro-1H-benzo[de]isoquinolin-6-one (PubChem CID 134878832) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 5-azido-2-(4-methylphenyl)sulfonyl-4,5-dihydro-1H-benzo[de]isoquinolin-6-one.
| Compound Name | 5-azido-2-(4-methylphenyl)sulfonyl-4,5-dihydro-1H-benzo[de]isoquinolin-6-one |
|---|---|
| PubChem CID | 134878832 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 5-azido-2-(4-methylphenyl)sulfonyl-4,5-dihydro-1H-benzo[de]isoquinolin-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C=C3CC(N=[N+]=[N-])C(=O)c4cccc(c43)C2)cc1 |
| InChI | InChI=1S/C19H16N4O3S/c1-12-5-7-15(8-6-12)27(25,26)23-10-13-3-2-4-16-18(13)14(11-23)9-17(19(16)24)21-22-20/h2-8,11,17H,9-10H2,1H3 |
| InChIKey | AECNFWDBEWRCOL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 103.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|