C27H48O2SSi2 — CID 134879371
tert-butyl-dimethyl-[[(2S,5S,6R)-5-methyl-6-[(Z)-2-phenylsulfanyl-2-triethylsilylethenyl]oxan-2-yl]methoxy]silane (PubChem CID 134879371) has the molecular formula C27H48O2SSi2 and a molecular weight of 492.92 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,5S,6R)-5-methyl-6-[(Z)-2-phenylsulfanyl-2-triethylsilylethenyl]oxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,5S,6R)-5-methyl-6-[(Z)-2-phenylsulfanyl-2-triethylsilylethenyl]oxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 134879371 |
| Molecular Formula | C27H48O2SSi2 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,5S,6R)-5-methyl-6-[(Z)-2-phenylsulfanyl-2-triethylsilylethenyl]oxan-2-yl]methoxy]silane |
| SMILES | CC[Si](CC)(CC)/C(=C/[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)CC[C@@H]1C)Sc1ccccc1 |
| InChI | InChI=1S/C27H48O2SSi2/c1-10-32(11-2,12-3)26(30-24-16-14-13-15-17-24)20-25-22(4)18-19-23(29-25)21-28-31(8,9)27(5,6)7/h13-17,20,22-23,25H,10-12,18-19,21H2,1-9H3/b26-20+/t22-,23-,25-/m0/s1 |
| InChIKey | HCRSVXFFVWLITJ-CXJABIJHSA-N |
| XLogP | 8.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|