C45H72O2SSi — CID 10908678
tri(propan-2-yl)-[2-[(2R,5Z)-5-[(4E,8E,12E)-4,9,13,17-tetramethyl-3-phenylsulfanyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoxy]silane (PubChem CID 10908678) has the molecular formula C45H72O2SSi and a molecular weight of 705.22 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[(2R,5Z)-5-[(4E,8E,12E)-4,9,13,17-tetramethyl-3-phenylsulfanyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoxy]silane.
| Compound Name | tri(propan-2-yl)-[2-[(2R,5Z)-5-[(4E,8E,12E)-4,9,13,17-tetramethyl-3-phenylsulfanyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoxy]silane |
|---|---|
| PubChem CID | 10908678 |
| Molecular Formula | C45H72O2SSi |
| Molecular Weight | 705.22 g/mol |
| Exact Mass | 704.50 |
| IUPAC Name | tri(propan-2-yl)-[2-[(2R,5Z)-5-[(4E,8E,12E)-4,9,13,17-tetramethyl-3-phenylsulfanyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoxy]silane |
| SMILES | C=C(CO[Si](C(C)C)(C(C)C)C(C)C)[C@H]1CC/C(=C/CC(Sc2ccccc2)/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CO1 |
| InChI | InChI=1S/C45H72O2SSi/c1-34(2)20-18-22-39(10)24-19-23-38(9)21-16-17-25-40(11)45(48-43-26-14-13-15-27-43)31-29-42-28-30-44(46-33-42)41(12)32-47-49(35(3)4,36(5)6)37(7)8/h13-15,20-21,24-27,29,35-37,44-45H,12,16-19,22-23,28,30-33H2,1-11H3/b38-21+,39-24+,40-25+,42-29-/t44-,45?/m1/s1 |
| InChIKey | DZUXSPFKBPSQIW-RHKBRWBTSA-N |
| XLogP | 14.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.22 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|