C20H32O3SSi — CID 10959875
(2R,3S,6R)-2-(hydroxymethyl)-6-[(Z)-2-phenylsulfanyl-2-triethylsilylethenyl]oxan-3-ol (PubChem CID 10959875) has the molecular formula C20H32O3SSi and a molecular weight of 380.63 g/mol. Its IUPAC name is (2R,3S,6R)-2-(hydroxymethyl)-6-[(Z)-2-phenylsulfanyl-2-triethylsilylethenyl]oxan-3-ol.
| Compound Name | (2R,3S,6R)-2-(hydroxymethyl)-6-[(Z)-2-phenylsulfanyl-2-triethylsilylethenyl]oxan-3-ol |
|---|---|
| PubChem CID | 10959875 |
| Molecular Formula | C20H32O3SSi |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (2R,3S,6R)-2-(hydroxymethyl)-6-[(Z)-2-phenylsulfanyl-2-triethylsilylethenyl]oxan-3-ol |
| SMILES | CC[Si](CC)(CC)/C(=C/[C@H]1CC[C@H](O)[C@@H](CO)O1)Sc1ccccc1 |
| InChI | InChI=1S/C20H32O3SSi/c1-4-25(5-2,6-3)20(24-17-10-8-7-9-11-17)14-16-12-13-18(22)19(15-21)23-16/h7-11,14,16,18-19,21-22H,4-6,12-13,15H2,1-3H3/b20-14+/t16-,18+,19-/m1/s1 |
| InChIKey | FSLXHCLEEXRAIV-AECLBVMZSA-N |
| XLogP | 4.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|