C20H24FNO5 — CID 134879735
tert-butyl 4-fluoro-1-(hydroxymethyl)-5-(methoxymethoxy)-1,2-dihydrobenzo[e]indole-3-carboxylate (PubChem CID 134879735) has the molecular formula C20H24FNO5 and a molecular weight of 377.41 g/mol. Its IUPAC name is tert-butyl 4-fluoro-1-(hydroxymethyl)-5-(methoxymethoxy)-1,2-dihydrobenzo[e]indole-3-carboxylate.
| Compound Name | tert-butyl 4-fluoro-1-(hydroxymethyl)-5-(methoxymethoxy)-1,2-dihydrobenzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 134879735 |
| Molecular Formula | C20H24FNO5 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | tert-butyl 4-fluoro-1-(hydroxymethyl)-5-(methoxymethoxy)-1,2-dihydrobenzo[e]indole-3-carboxylate |
| SMILES | COCOc1c(F)c2c(c3ccccc13)C(CO)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24FNO5/c1-20(2,3)27-19(24)22-9-12(10-23)15-13-7-5-6-8-14(13)18(26-11-25-4)16(21)17(15)22/h5-8,12,23H,9-11H2,1-4H3 |
| InChIKey | NJXTUUNFXAFEIX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|