C21H26INO7S — CID 10940725
tert-butyl (1S)-4-iodo-5-(methoxymethoxy)-1-(methylsulfonyloxymethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate (PubChem CID 10940725) has the molecular formula C21H26INO7S and a molecular weight of 563.41 g/mol. Its IUPAC name is tert-butyl (1S)-4-iodo-5-(methoxymethoxy)-1-(methylsulfonyloxymethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate.
| Compound Name | tert-butyl (1S)-4-iodo-5-(methoxymethoxy)-1-(methylsulfonyloxymethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 10940725 |
| Molecular Formula | C21H26INO7S |
| Molecular Weight | 563.41 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | tert-butyl (1S)-4-iodo-5-(methoxymethoxy)-1-(methylsulfonyloxymethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate |
| SMILES | COCOc1c(I)c2c(c3ccccc13)[C@H](COS(C)(=O)=O)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H26INO7S/c1-21(2,3)30-20(24)23-10-13(11-29-31(5,25)26)16-14-8-6-7-9-15(14)19(28-12-27-4)17(22)18(16)23/h6-9,13H,10-12H2,1-5H3/t13-/m0/s1 |
| InChIKey | PFYYDSAAIDKJHC-ZDUSSCGKSA-N |
| XLogP | 4.24 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|