C12H22N2O6S — CID 142652721
tert-butyl 3-methoxyimino-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 142652721) has the molecular formula C12H22N2O6S and a molecular weight of 322.38 g/mol. Its IUPAC name is tert-butyl 3-methoxyimino-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-methoxyimino-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142652721 |
| Molecular Formula | C12H22N2O6S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | tert-butyl 3-methoxyimino-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CON=C1CN(C(=O)OC(C)(C)C)CC1COS(C)(=O)=O |
| InChI | InChI=1S/C12H22N2O6S/c1-12(2,3)20-11(15)14-6-9(8-19-21(5,16)17)10(7-14)13-18-4/h9H,6-8H2,1-5H3 |
| InChIKey | RHTACPGDSGVZPE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|