C29H48O5Si2 — CID 134883369
methyl (1S,2R,4R,7R,8S)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxybicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 134883369) has the molecular formula C29H48O5Si2 and a molecular weight of 532.87 g/mol. Its IUPAC name is methyl (1S,2R,4R,7R,8S)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxybicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2R,4R,7R,8S)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxybicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 134883369 |
| Molecular Formula | C29H48O5Si2 |
| Molecular Weight | 532.87 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | methyl (1S,2R,4R,7R,8S)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxybicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(OCc3ccccc3)C=C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H48O5Si2/c1-27(2,3)35(8,9)33-24-22-17-18-29(19-23(22)26(30)31-7,32-20-21-15-13-12-14-16-21)25(24)34-36(10,11)28(4,5)6/h12-18,22-25H,19-20H2,1-11H3/t22-,23+,24+,25-,29-/m0/s1 |
| InChIKey | GVDIRIPTZXUNPJ-QOCQIACQSA-N |
| XLogP | 7.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.87 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|