C25H46BCl — CID 134886916
[(1E,5E,9E)-11-chloro-3,3,6,10-tetramethylundeca-1,5,9-trienyl]-bis(3-methylbutan-2-yl)borane (PubChem CID 134886916) has the molecular formula C25H46BCl and a molecular weight of 392.91 g/mol. Its IUPAC name is [(1E,5E,9E)-11-chloro-3,3,6,10-tetramethylundeca-1,5,9-trienyl]-bis(3-methylbutan-2-yl)borane.
| Compound Name | [(1E,5E,9E)-11-chloro-3,3,6,10-tetramethylundeca-1,5,9-trienyl]-bis(3-methylbutan-2-yl)borane |
|---|---|
| PubChem CID | 134886916 |
| Molecular Formula | C25H46BCl |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | [(1E,5E,9E)-11-chloro-3,3,6,10-tetramethylundeca-1,5,9-trienyl]-bis(3-methylbutan-2-yl)borane |
| SMILES | C/C(=C\CC/C(C)=C/CC(C)(C)/C=C/B(C(C)C(C)C)C(C)C(C)C)CCl |
| InChI | InChI=1S/C25H46BCl/c1-19(2)23(7)26(24(8)20(3)4)17-16-25(9,10)15-14-21(5)12-11-13-22(6)18-27/h13-14,16-17,19-20,23-24H,11-12,15,18H2,1-10H3/b17-16+,21-14+,22-13+ |
| InChIKey | QBRFLTLQKMKDJK-QSQFHBBGSA-N |
| XLogP | 9.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|