C32H58O6Si2 — CID 134887080
(1E,7E,9E)-1-[(2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propoxy]-6-(oxan-2-yloxy)dodeca-1,7,9-trien-4-yn-3-ol (PubChem CID 134887080) has the molecular formula C32H58O6Si2 and a molecular weight of 594.98 g/mol. Its IUPAC name is (1E,7E,9E)-1-[(2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propoxy]-6-(oxan-2-yloxy)dodeca-1,7,9-trien-4-yn-3-ol.
| Compound Name | (1E,7E,9E)-1-[(2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propoxy]-6-(oxan-2-yloxy)dodeca-1,7,9-trien-4-yn-3-ol |
|---|---|
| PubChem CID | 134887080 |
| Molecular Formula | C32H58O6Si2 |
| Molecular Weight | 594.98 g/mol |
| Exact Mass | 594.38 |
| IUPAC Name | (1E,7E,9E)-1-[(2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propoxy]-6-(oxan-2-yloxy)dodeca-1,7,9-trien-4-yn-3-ol |
| SMILES | CC/C=C/C=C/C(C#CC(O)/C=C/OC[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)OC1CCCCO1 |
| InChI | InChI=1S/C32H58O6Si2/c1-12-13-14-15-18-28(37-30-19-16-17-23-35-30)21-20-27(33)22-24-34-25-29(38-40(10,11)32(5,6)7)26-36-39(8,9)31(2,3)4/h13-15,18,22,24,27-30,33H,12,16-17,19,23,25-26H2,1-11H3/b14-13+,18-15+,24-22+/t27?,28?,29-,30?/m1/s1 |
| InChIKey | HCTVJKIGKPQGIU-GABZZLMPSA-N |
| XLogP | 7.73 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.98 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|