About CID 134888888
CID 134888888 (PubChem CID 134888888) has the molecular formula C42H48ClP2Si2Zr
and a molecular weight of 797.64 g/mol.
Molecular Properties
| Compound Name | CID 134888888 |
| PubChem CID | 134888888 |
| Molecular Formula | C42H48ClP2Si2Zr |
| Molecular Weight | 797.64 g/mol |
| Exact Mass | 795.15 |
| IUPAC Name | — |
| SMILES | C[Si](C)(CCP(c1ccccc1)c1ccccc1)[C]1[CH][CH][CH][CH]1.C[Si](C)(CCP(c1ccccc1)c1ccccc1)[C]1[CH][CH][CH][CH]1.Cl[Zr] |
| InChI | InChI=1S/2C21H24PSi.ClH.Zr/c2*1-23(2,21-15-9-10-16-21)18-17-22(19-11-5-3-6-12-19)20-13-7-4-8-14-20;;/h2*3-16H,17-18H2,1-2H3;1H;/q;;;+1/p-1 |
| InChIKey | OHVDZNFTUWTFMQ-UHFFFAOYSA-M |
| XLogP | 10.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 797.64 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 134888888 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134888888?
The IUPAC name of CID 134888888 (CID 134888888) is not available.
What is the SMILES notation for CID 134888888?
The canonical SMILES for CID 134888888 is C[Si](C)(CCP(c1ccccc1)c1ccccc1)[C]1[CH][CH][CH][CH]1.C[Si](C)(CCP(c1ccccc1)c1ccccc1)[C]1[CH][CH][CH][CH]1.Cl[Zr].
What is the InChIKey of CID 134888888?
The InChIKey is OHVDZNFTUWTFMQ-UHFFFAOYSA-M. The full InChI is InChI=1S/2C21H24PSi.ClH.Zr/c2*1-23(2,21-15-9-10-16-21)18-17-22(19-11-5-3-6-12-19)20-13-7-4-8-14-20;;/h2*3-16H,17-18H2,1-2H3;1H;/q;;;+1/p-1.
What are the key properties of CID 134888888?
CID 134888888 has a molecular weight of 797.64 g/mol, XLogP of 10.23, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134888888 is sourced from PubChem (CID 134888888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).