C29H46O5Si — CID 134889176
(5S,6S,7R,8S)-2,2,7-trimethyl-8-phenylmethoxy-7-[tri(propan-2-yl)silyloxymethyl]-1,3-dioxaspiro[4.5]dec-9-ene-6-carbaldehyde (PubChem CID 134889176) has the molecular formula C29H46O5Si and a molecular weight of 502.77 g/mol. Its IUPAC name is (5S,6S,7R,8S)-2,2,7-trimethyl-8-phenylmethoxy-7-[tri(propan-2-yl)silyloxymethyl]-1,3-dioxaspiro[4.5]dec-9-ene-6-carbaldehyde.
| Compound Name | (5S,6S,7R,8S)-2,2,7-trimethyl-8-phenylmethoxy-7-[tri(propan-2-yl)silyloxymethyl]-1,3-dioxaspiro[4.5]dec-9-ene-6-carbaldehyde |
|---|---|
| PubChem CID | 134889176 |
| Molecular Formula | C29H46O5Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | (5S,6S,7R,8S)-2,2,7-trimethyl-8-phenylmethoxy-7-[tri(propan-2-yl)silyloxymethyl]-1,3-dioxaspiro[4.5]dec-9-ene-6-carbaldehyde |
| SMILES | CC(C)[Si](OC[C@]1(C)[C@@H](OCc2ccccc2)C=C[C@@]2(COC(C)(C)O2)[C@H]1C=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H46O5Si/c1-21(2)35(22(3)4,23(5)6)33-19-28(9)25(17-30)29(20-32-27(7,8)34-29)16-15-26(28)31-18-24-13-11-10-12-14-24/h10-17,21-23,25-26H,18-20H2,1-9H3/t25-,26-,28-,29+/m0/s1 |
| InChIKey | YRVNMOIJNUMSFO-ZSLRCHCDSA-N |
| XLogP | 6.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|