C33H42O5Si — CID 11763323
1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone (PubChem CID 11763323) has the molecular formula C33H42O5Si and a molecular weight of 546.78 g/mol. Its IUPAC name is 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone.
| Compound Name | 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone |
|---|---|
| PubChem CID | 11763323 |
| Molecular Formula | C33H42O5Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone |
| SMILES | CC1(C)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C(=O)COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C33H42O5Si/c1-31(2,3)39(6,7)36-24-29-30(38-32(4,5)37-29)28(34)23-35-33(25-17-11-8-12-18-25,26-19-13-9-14-20-26)27-21-15-10-16-22-27/h8-22,29-30H,23-24H2,1-7H3/t29-,30+/m0/s1 |
| InChIKey | VKDKIPOGDFFKNM-XZWHSSHBSA-N |
| XLogP | 7.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|