C31H50O6Si — CID 101152477
1-[(4R,6R,8R,10S,13R)-13-[tert-butyl(dimethyl)silyl]oxy-13-methyl-10-(2-phenylmethoxyethyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-4-yl]propan-2-one (PubChem CID 101152477) has the molecular formula C31H50O6Si and a molecular weight of 546.82 g/mol. Its IUPAC name is 1-[(4R,6R,8R,10S,13R)-13-[tert-butyl(dimethyl)silyl]oxy-13-methyl-10-(2-phenylmethoxyethyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-4-yl]propan-2-one.
| Compound Name | 1-[(4R,6R,8R,10S,13R)-13-[tert-butyl(dimethyl)silyl]oxy-13-methyl-10-(2-phenylmethoxyethyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-4-yl]propan-2-one |
|---|---|
| PubChem CID | 101152477 |
| Molecular Formula | C31H50O6Si |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | 1-[(4R,6R,8R,10S,13R)-13-[tert-butyl(dimethyl)silyl]oxy-13-methyl-10-(2-phenylmethoxyethyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-4-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1CCC[C@@]2(CC[C@@]3(O[C@H](CCOCc4ccccc4)CC[C@@]3(C)O[Si](C)(C)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C31H50O6Si/c1-24(32)22-27-14-11-17-30(34-27)19-20-31(36-30)29(5,37-38(6,7)28(2,3)4)18-15-26(35-31)16-21-33-23-25-12-9-8-10-13-25/h8-10,12-13,26-27H,11,14-23H2,1-7H3/t26-,27+,29+,30+,31+/m0/s1 |
| InChIKey | IAEJGQSZCOWZIR-KCLYVBLVSA-N |
| XLogP | 7.30 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|