C26H38O5Si — CID 11167039
(1R,2S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(phenylmethoxymethoxymethyl)-2-prop-2-enyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11167039) has the molecular formula C26H38O5Si and a molecular weight of 458.67 g/mol. Its IUPAC name is (1R,2S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(phenylmethoxymethoxymethyl)-2-prop-2-enyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(phenylmethoxymethoxymethyl)-2-prop-2-enyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11167039 |
| Molecular Formula | C26H38O5Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (1R,2S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(phenylmethoxymethoxymethyl)-2-prop-2-enyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C=CC[C@@H]1C(=O)C[C@]2(CO[Si](C)(C)C(C)(C)C)C=C[C@@]1(COCOCc1ccccc1)O2 |
| InChI | InChI=1S/C26H38O5Si/c1-7-11-22-23(27)16-25(18-30-32(5,6)24(2,3)4)14-15-26(22,31-25)19-29-20-28-17-21-12-9-8-10-13-21/h7-10,12-15,22H,1,11,16-20H2,2-6H3/t22-,25+,26+/m1/s1 |
| InChIKey | VRJHUQPRLQOLFP-RZFJZAQRSA-N |
| XLogP | 5.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|