C26H42O5Si — CID 134923234
2-[(2S,3R,5S,6R)-2,6-dimethyl-6-(4-methylpent-3-enyl)-5-(phenylmethoxymethoxy)-3-trimethylsilyloxyoxan-2-yl]acetaldehyde (PubChem CID 134923234) has the molecular formula C26H42O5Si and a molecular weight of 462.70 g/mol. Its IUPAC name is 2-[(2S,3R,5S,6R)-2,6-dimethyl-6-(4-methylpent-3-enyl)-5-(phenylmethoxymethoxy)-3-trimethylsilyloxyoxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,5S,6R)-2,6-dimethyl-6-(4-methylpent-3-enyl)-5-(phenylmethoxymethoxy)-3-trimethylsilyloxyoxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 134923234 |
| Molecular Formula | C26H42O5Si |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 2-[(2S,3R,5S,6R)-2,6-dimethyl-6-(4-methylpent-3-enyl)-5-(phenylmethoxymethoxy)-3-trimethylsilyloxyoxan-2-yl]acetaldehyde |
| SMILES | CC(C)=CCC[C@@]1(C)O[C@@](C)(CC=O)[C@H](O[Si](C)(C)C)C[C@@H]1OCOCc1ccccc1 |
| InChI | InChI=1S/C26H42O5Si/c1-21(2)12-11-15-25(3)23(29-20-28-19-22-13-9-8-10-14-22)18-24(30-32(5,6)7)26(4,31-25)16-17-27/h8-10,12-14,17,23-24H,11,15-16,18-20H2,1-7H3/t23-,24+,25+,26-/m0/s1 |
| InChIKey | AQLYGITVHRBVPP-QUMGSSFMSA-N |
| XLogP | 6.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|