C27H44O5Si — CID 102124894
(5E,7E,9S,10S)-1-[tert-butyl(dimethyl)silyl]oxy-10-(methoxymethoxy)-9-methyl-11-phenylmethoxyundeca-5,7-dien-4-one (PubChem CID 102124894) has the molecular formula C27H44O5Si and a molecular weight of 476.73 g/mol. Its IUPAC name is (5E,7E,9S,10S)-1-[tert-butyl(dimethyl)silyl]oxy-10-(methoxymethoxy)-9-methyl-11-phenylmethoxyundeca-5,7-dien-4-one.
| Compound Name | (5E,7E,9S,10S)-1-[tert-butyl(dimethyl)silyl]oxy-10-(methoxymethoxy)-9-methyl-11-phenylmethoxyundeca-5,7-dien-4-one |
|---|---|
| PubChem CID | 102124894 |
| Molecular Formula | C27H44O5Si |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | (5E,7E,9S,10S)-1-[tert-butyl(dimethyl)silyl]oxy-10-(methoxymethoxy)-9-methyl-11-phenylmethoxyundeca-5,7-dien-4-one |
| SMILES | COCO[C@H](COCc1ccccc1)[C@@H](C)/C=C/C=C/C(=O)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H44O5Si/c1-23(26(31-22-29-5)21-30-20-24-15-9-8-10-16-24)14-11-12-17-25(28)18-13-19-32-33(6,7)27(2,3)4/h8-12,14-17,23,26H,13,18-22H2,1-7H3/b14-11+,17-12+/t23-,26+/m0/s1 |
| InChIKey | GWXUWHPGUARXEJ-HYGJXTIGSA-N |
| XLogP | 6.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|