C22H36O4Si — CID 10596709
(3S,4R)-3-hydroxy-4-(methoxymethoxy)-2-methylidene-4-phenyl-1-tri(propan-2-yl)silylbutan-1-one (PubChem CID 10596709) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-4-(methoxymethoxy)-2-methylidene-4-phenyl-1-tri(propan-2-yl)silylbutan-1-one.
| Compound Name | (3S,4R)-3-hydroxy-4-(methoxymethoxy)-2-methylidene-4-phenyl-1-tri(propan-2-yl)silylbutan-1-one |
|---|---|
| PubChem CID | 10596709 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (3S,4R)-3-hydroxy-4-(methoxymethoxy)-2-methylidene-4-phenyl-1-tri(propan-2-yl)silylbutan-1-one |
| SMILES | C=C(C(=O)[Si](C(C)C)(C(C)C)C(C)C)[C@H](O)[C@H](OCOC)c1ccccc1 |
| InChI | InChI=1S/C22H36O4Si/c1-15(2)27(16(3)4,17(5)6)22(24)18(7)20(23)21(26-14-25-8)19-12-10-9-11-13-19/h9-13,15-17,20-21,23H,7,14H2,1-6,8H3/t20-,21+/m0/s1 |
| InChIKey | PYGAKPBSFILYCU-LEWJYISDSA-N |
| XLogP | 5.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|