C30H44O6Si — CID 134832963
(5S,6R,9R)-6-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-1-enyl]-4-(methoxymethoxy)-9-methyl-8-(phenylmethoxymethyl)-1-oxaspiro[4.5]deca-3,7-dien-2-one (PubChem CID 134832963) has the molecular formula C30H44O6Si and a molecular weight of 528.76 g/mol. Its IUPAC name is (5S,6R,9R)-6-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-1-enyl]-4-(methoxymethoxy)-9-methyl-8-(phenylmethoxymethyl)-1-oxaspiro[4.5]deca-3,7-dien-2-one.
| Compound Name | (5S,6R,9R)-6-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-1-enyl]-4-(methoxymethoxy)-9-methyl-8-(phenylmethoxymethyl)-1-oxaspiro[4.5]deca-3,7-dien-2-one |
|---|---|
| PubChem CID | 134832963 |
| Molecular Formula | C30H44O6Si |
| Molecular Weight | 528.76 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | (5S,6R,9R)-6-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-1-enyl]-4-(methoxymethoxy)-9-methyl-8-(phenylmethoxymethyl)-1-oxaspiro[4.5]deca-3,7-dien-2-one |
| SMILES | COCOC1=CC(=O)O[C@]12C[C@@H](C)C(COCc1ccccc1)=C[C@H]2/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H44O6Si/c1-22(18-35-37(7,8)29(3,4)5)14-26-15-25(20-33-19-24-12-10-9-11-13-24)23(2)17-30(26)27(34-21-32-6)16-28(31)36-30/h9-16,23,26H,17-21H2,1-8H3/b22-14+/t23-,26-,30+/m1/s1 |
| InChIKey | PFASESBUMUWVSD-BUMKOWSPSA-N |
| XLogP | 6.55 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.76 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|