C22H32O4Si — CID 10960080
methyl (E)-3-[(1R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-phenylcyclopent-2-en-1-yl]prop-2-enoate (PubChem CID 10960080) has the molecular formula C22H32O4Si and a molecular weight of 388.58 g/mol. Its IUPAC name is methyl (E)-3-[(1R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-phenylcyclopent-2-en-1-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-phenylcyclopent-2-en-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10960080 |
| Molecular Formula | C22H32O4Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | methyl (E)-3-[(1R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-phenylcyclopent-2-en-1-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@]1(O[Si](C)(C)C(C)(C)C)C[C@H](c2ccccc2)C=C1OC |
| InChI | InChI=1S/C22H32O4Si/c1-21(2,3)27(6,7)26-22(14-13-20(23)25-5)16-18(15-19(22)24-4)17-11-9-8-10-12-17/h8-15,18H,16H2,1-7H3/b14-13+/t18-,22+/m1/s1 |
| InChIKey | FKSUJQKXUZUSPM-PPQBYTHQSA-N |
| XLogP | 5.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|