C23H34O5Si — CID 10927915
tert-butyl 4,5-dimethoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (PubChem CID 10927915) has the molecular formula C23H34O5Si and a molecular weight of 418.61 g/mol. Its IUPAC name is tert-butyl 4,5-dimethoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
| Compound Name | tert-butyl 4,5-dimethoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 10927915 |
| Molecular Formula | C23H34O5Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | tert-butyl 4,5-dimethoxy-3-phenyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| SMILES | COC1=CCC(C(=O)OC(C)(C)C)=CC(c2ccccc2)C1(OC)O[Si](C)(C)C |
| InChI | InChI=1S/C23H34O5Si/c1-22(2,3)27-21(24)18-14-15-20(25-4)23(26-5,28-29(6,7)8)19(16-18)17-12-10-9-11-13-17/h9-13,15-16,19H,14H2,1-8H3 |
| InChIKey | NEDYUKQMCXRVFS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|