C32H56O4Si — CID 138980729
tert-butyl-dimethyl-[(4R,5R)-5-methyl-4-(4-phenylmethoxybut-1-en-2-yl)-7-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]heptoxy]silane (PubChem CID 138980729) has the molecular formula C32H56O4Si and a molecular weight of 532.88 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4R,5R)-5-methyl-4-(4-phenylmethoxybut-1-en-2-yl)-7-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]heptoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(4R,5R)-5-methyl-4-(4-phenylmethoxybut-1-en-2-yl)-7-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]heptoxy]silane |
|---|---|
| PubChem CID | 138980729 |
| Molecular Formula | C32H56O4Si |
| Molecular Weight | 532.88 g/mol |
| Exact Mass | 532.39 |
| IUPAC Name | tert-butyl-dimethyl-[(4R,5R)-5-methyl-4-(4-phenylmethoxybut-1-en-2-yl)-7-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]heptoxy]silane |
| SMILES | C=C(CCOCc1ccccc1)[C@H](CCCO[Si](C)(C)C(C)(C)C)[C@H](C)CC[C@H]1OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C32H56O4Si/c1-25(19-20-29-31(6,7)36-32(8,9)35-29)28(18-15-22-34-37(10,11)30(3,4)5)26(2)21-23-33-24-27-16-13-12-14-17-27/h12-14,16-17,25,28-29H,2,15,18-24H2,1,3-11H3/t25-,28-,29-/m1/s1 |
| InChIKey | MSLQEMCUWVHBNH-MOZWKJSSSA-N |
| XLogP | 8.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.88 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|