C19H26LiNO3 — CID 134889225
lithium [(E)-3-cyclohexylprop-2-enoxy]carbonyl-[(1S)-2-methoxy-1-phenylethyl]azanide (PubChem CID 134889225) has the molecular formula C19H26LiNO3 and a molecular weight of 323.36 g/mol. Its IUPAC name is lithium [(E)-3-cyclohexylprop-2-enoxy]carbonyl-[(1S)-2-methoxy-1-phenylethyl]azanide.
| Compound Name | lithium [(E)-3-cyclohexylprop-2-enoxy]carbonyl-[(1S)-2-methoxy-1-phenylethyl]azanide |
|---|---|
| PubChem CID | 134889225 |
| Molecular Formula | C19H26LiNO3 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | lithium [(E)-3-cyclohexylprop-2-enoxy]carbonyl-[(1S)-2-methoxy-1-phenylethyl]azanide |
| SMILES | COC[C@@H]([N-]C(=O)OC/C=C/C1CCCCC1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C19H27NO3.Li/c1-22-15-18(17-12-6-3-7-13-17)20-19(21)23-14-8-11-16-9-4-2-5-10-16;/h3,6-8,11-13,16,18H,2,4-5,9-10,14-15H2,1H3,(H,20,21);/q;+1/p-1/b11-8+;/t18-;/m1./s1 |
| InChIKey | QMGCDWICJAHSKH-BCZBIICQSA-M |
| XLogP | 2.02 |
| TPSA | 49.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|