C23H28LiNO3 — CID 134889316
lithium [(E)-3-cyclohexylprop-2-enoxy]carbonyl-[(1S)-2-methoxy-1-naphthalen-1-ylethyl]azanide (PubChem CID 134889316) has the molecular formula C23H28LiNO3 and a molecular weight of 373.42 g/mol. Its IUPAC name is lithium [(E)-3-cyclohexylprop-2-enoxy]carbonyl-[(1S)-2-methoxy-1-naphthalen-1-ylethyl]azanide.
| Compound Name | lithium [(E)-3-cyclohexylprop-2-enoxy]carbonyl-[(1S)-2-methoxy-1-naphthalen-1-ylethyl]azanide |
|---|---|
| PubChem CID | 134889316 |
| Molecular Formula | C23H28LiNO3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | lithium [(E)-3-cyclohexylprop-2-enoxy]carbonyl-[(1S)-2-methoxy-1-naphthalen-1-ylethyl]azanide |
| SMILES | COC[C@@H]([N-]C(=O)OC/C=C/C1CCCCC1)c1cccc2ccccc12.[Li+] |
| InChI | InChI=1S/C23H29NO3.Li/c1-26-17-22(21-15-7-13-19-12-5-6-14-20(19)21)24-23(25)27-16-8-11-18-9-3-2-4-10-18;/h5-8,11-15,18,22H,2-4,9-10,16-17H2,1H3,(H,24,25);/q;+1/p-1/b11-8+;/t22-;/m1./s1 |
| InChIKey | RILWVVLCJFVYQI-OADNXLBASA-M |
| XLogP | 3.18 |
| TPSA | 49.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|