C24H36O6SSi — CID 134889368
(4aR,8aS)-4a-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2-dimethyl-3,5,8,8a-tetrahydrochromen-4-one (PubChem CID 134889368) has the molecular formula C24H36O6SSi and a molecular weight of 480.70 g/mol. Its IUPAC name is (4aR,8aS)-4a-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2-dimethyl-3,5,8,8a-tetrahydrochromen-4-one.
| Compound Name | (4aR,8aS)-4a-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2-dimethyl-3,5,8,8a-tetrahydrochromen-4-one |
|---|---|
| PubChem CID | 134889368 |
| Molecular Formula | C24H36O6SSi |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (4aR,8aS)-4a-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2-dimethyl-3,5,8,8a-tetrahydrochromen-4-one |
| SMILES | COC1C=C(O[Si](C)(C)C(C)(C)C)C[C@@H]2OC(C)(C)CC(=O)[C@]12S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H36O6SSi/c1-22(2,3)32(7,8)30-17-14-20(28-6)24(31(26,27)18-12-10-9-11-13-18)19(25)16-23(4,5)29-21(24)15-17/h9-14,20-21H,15-16H2,1-8H3/t20?,21-,24-/m0/s1 |
| InChIKey | XJWYGWHAXXEIJI-AVJWOPLCSA-N |
| XLogP | 4.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|