C7H8Cl2O4S2 — CID 134891028
(2-chloro-4,5,6,7-tetrahydro-1,3-benzodithiol-2-yl) perchlorate (PubChem CID 134891028) has the molecular formula C7H8Cl2O4S2 and a molecular weight of 291.18 g/mol. Its IUPAC name is (2-chloro-4,5,6,7-tetrahydro-1,3-benzodithiol-2-yl) perchlorate.
| Compound Name | (2-chloro-4,5,6,7-tetrahydro-1,3-benzodithiol-2-yl) perchlorate |
|---|---|
| PubChem CID | 134891028 |
| Molecular Formula | C7H8Cl2O4S2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 289.92 |
| IUPAC Name | (2-chloro-4,5,6,7-tetrahydro-1,3-benzodithiol-2-yl) perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])OC1(Cl)SC2=C(CCCC2)S1 |
| InChI | InChI=1S/C7H8Cl2O4S2/c8-7(13-9(10,11)12)14-5-3-1-2-4-6(5)15-7/h1-4H2 |
| InChIKey | NFNNTYHYQCZTQE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|