C6H8ClNS2 — CID 135051498
3-chloro-2,3λ4-dithiabicyclo[3.3.0]octa-1(5),3-dien-4-amine (PubChem CID 135051498) has the molecular formula C6H8ClNS2 and a molecular weight of 193.72 g/mol. Its IUPAC name is 3-chloro-2,3λ4-dithiabicyclo[3.3.0]octa-1(5),3-dien-4-amine.
| Compound Name | 3-chloro-2,3λ4-dithiabicyclo[3.3.0]octa-1(5),3-dien-4-amine |
|---|---|
| PubChem CID | 135051498 |
| Molecular Formula | C6H8ClNS2 |
| Molecular Weight | 193.72 g/mol |
| Exact Mass | 192.98 |
| IUPAC Name | 3-chloro-2,3λ4-dithiabicyclo[3.3.0]octa-1(5),3-dien-4-amine |
| SMILES | NC1=S(Cl)SC2=C1CCC2 |
| InChI | InChI=1S/C6H8ClNS2/c7-10-6(8)4-2-1-3-5(4)9-10/h1-3,8H2 |
| InChIKey | MLANXMZXNIIJAB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|