C10H18S — CID 134893334
(2E)-7-methyl-1-methylsulfanylocta-2,6-diene (PubChem CID 134893334) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is (2E)-7-methyl-1-methylsulfanylocta-2,6-diene.
| Compound Name | (2E)-7-methyl-1-methylsulfanylocta-2,6-diene |
|---|---|
| PubChem CID | 134893334 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (2E)-7-methyl-1-methylsulfanylocta-2,6-diene |
| SMILES | CSC/C=C/CCC=C(C)C |
| InChI | InChI=1S/C10H18S/c1-10(2)8-6-4-5-7-9-11-3/h5,7-8H,4,6,9H2,1-3H3/b7-5+ |
| InChIKey | BWCNJZQAHUWEBE-FNORWQNLSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|