C11H16O4 — CID 134897004
methyl 3-[(1R,2S,5R)-3,3-dimethyl-4-oxo-6-oxabicyclo[3.1.0]hexan-2-yl]propanoate (PubChem CID 134897004) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is methyl 3-[(1R,2S,5R)-3,3-dimethyl-4-oxo-6-oxabicyclo[3.1.0]hexan-2-yl]propanoate.
| Compound Name | methyl 3-[(1R,2S,5R)-3,3-dimethyl-4-oxo-6-oxabicyclo[3.1.0]hexan-2-yl]propanoate |
|---|---|
| PubChem CID | 134897004 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl 3-[(1R,2S,5R)-3,3-dimethyl-4-oxo-6-oxabicyclo[3.1.0]hexan-2-yl]propanoate |
| SMILES | COC(=O)CC[C@@H]1[C@H]2O[C@H]2C(=O)C1(C)C |
| InChI | InChI=1S/C11H16O4/c1-11(2)6(4-5-7(12)14-3)8-9(15-8)10(11)13/h6,8-9H,4-5H2,1-3H3/t6-,8-,9-/m1/s1 |
| InChIKey | YOWKLTFCFWOKBV-FTLITQJKSA-N |
| XLogP | 0.93 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|