C5H15N3O2 — CID 134897398
azanium 2,2-dimethylpropyl(nitro)azanide (PubChem CID 134897398) has the molecular formula C5H15N3O2 and a molecular weight of 149.19 g/mol. Its IUPAC name is azanium 2,2-dimethylpropyl(nitro)azanide.
| Compound Name | azanium 2,2-dimethylpropyl(nitro)azanide |
|---|---|
| PubChem CID | 134897398 |
| Molecular Formula | C5H15N3O2 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | azanium 2,2-dimethylpropyl(nitro)azanide |
| SMILES | CC(C)(C)C[N-][N+](=O)[O-].[NH4+] |
| InChI | InChI=1S/C5H11N2O2.H3N/c1-5(2,3)4-6-7(8)9;/h4H2,1-3H3;1H3/q-1;/p+1 |
| InChIKey | CPYUOHSWPQJUTB-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 93.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|