C5H4O3 — CID 134897984
6,7-dideuterio-2,4-dioxabicyclo[3.2.0]hept-6-en-3-one (PubChem CID 134897984) has the molecular formula C5H4O3 and a molecular weight of 114.10 g/mol. Its IUPAC name is 6,7-dideuterio-2,4-dioxabicyclo[3.2.0]hept-6-en-3-one.
| Compound Name | 6,7-dideuterio-2,4-dioxabicyclo[3.2.0]hept-6-en-3-one |
|---|---|
| PubChem CID | 134897984 |
| Molecular Formula | C5H4O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | 6,7-dideuterio-2,4-dioxabicyclo[3.2.0]hept-6-en-3-one |
| SMILES | [2H]C1=C([2H])C2OC(=O)OC12 |
| InChI | InChI=1S/C5H4O3/c6-5-7-3-1-2-4(3)8-5/h1-4H/i1D,2D |
| InChIKey | RFEVPZXWJZCVKZ-QDNHWIQGSA-N |
| XLogP | 0.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|